Information card for entry 2229595
| Chemical name |
2-Ethyl-2,3-dihydro-1,2-benzothiazole-1,1,3-trione |
| Formula |
C9 H9 N O3 S |
| Calculated formula |
C9 H9 N O3 S |
| SMILES |
S1(=O)(=O)N(C(=O)c2c1cccc2)CC |
| Title of publication |
2-Ethyl-2,3-dihydro-1,2-benzothiazole-1,1,3-trione |
| Authors of publication |
Khan, Muneeb Hayat; Khan, Islam Ullah; Arshad, Muhammad Nadeem; Akkurt, Mehmet |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
4 |
| Pages of publication |
o887 |
| a |
10.4559 ± 0.0005 Å |
| b |
7.5484 ± 0.0005 Å |
| c |
12.9408 ± 0.0007 Å |
| α |
90° |
| β |
105.863 ± 0.002° |
| γ |
90° |
| Cell volume |
982.46 ± 0.1 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.061 |
| Residual factor for significantly intense reflections |
0.046 |
| Weighted residual factors for significantly intense reflections |
0.1319 |
| Weighted residual factors for all reflections included in the refinement |
0.1437 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.078 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229595.html