Information card for entry 2229623
| Common name |
6,6'-Diethoxy-2,2'-[hexane-1,6-diylbis(nitrilomethanylylidene)]diphenol <i>N</i>,<i>N</i>'-Bis(3-ethoxy-2-hydroxybenzylidene)hexane-1,6-diamine |
| Chemical name |
2-ethoxy-6-{[(6-{[(3-ethoxy-2- hydroxyphenyl)methylidene]amino}hexyl)imino]methyl}phenol |
| Formula |
C24 H32 N2 O4 |
| Calculated formula |
C24 H32 N2 O4 |
| SMILES |
CCOc1cccc(c1O)/C=N/CCCCCC/N=C/c1cccc(c1O)OCC |
| Title of publication |
6,6'-Diethoxy-2,2'-[hexane-1,6-diylbis(nitrilomethanylylidene)]diphenol |
| Authors of publication |
Ha, Kwang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
4 |
| Pages of publication |
o918 |
| a |
6.9094 ± 0.0013 Å |
| b |
6.9184 ± 0.0013 Å |
| c |
11.936 ± 0.002 Å |
| α |
91.271 ± 0.005° |
| β |
99.677 ± 0.004° |
| γ |
102.55 ± 0.004° |
| Cell volume |
547.98 ± 0.17 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1118 |
| Residual factor for significantly intense reflections |
0.0615 |
| Weighted residual factors for significantly intense reflections |
0.1331 |
| Weighted residual factors for all reflections included in the refinement |
0.1677 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.016 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229623.html
