Information card for entry 2230236
| Chemical name |
2,6-Bis[(4<i>R</i>,5<i>R</i>)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]pyridine |
| Formula |
C35 H27 N3 O2 |
| Calculated formula |
C35 H27 N3 O2 |
| SMILES |
c1ccc(cc1)[C@H]1N=C(O[C@@H]1c1ccccc1)c1cccc(n1)C1=N[C@@H]([C@H](O1)c1ccccc1)c1ccccc1 |
| Title of publication |
2,6-Bis[(4<i>R</i>,5<i>R</i>)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]pyridine |
| Authors of publication |
Lin, Ning; Deng, Yan-Qiu; Chen, Miao-Miao; Luo, Ren-Shi; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
6 |
| Pages of publication |
o1344 |
| a |
19.035 ± 0.002 Å |
| b |
6.5908 ± 0.0007 Å |
| c |
14.3001 ± 0.0015 Å |
| α |
90° |
| β |
129.454 ± 0.001° |
| γ |
90° |
| Cell volume |
1385.2 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
5 |
| Hermann-Mauguin space group symbol |
C 1 2 1 |
| Hall space group symbol |
C 2y |
| Residual factor for all reflections |
0.0371 |
| Residual factor for significantly intense reflections |
0.0337 |
| Weighted residual factors for significantly intense reflections |
0.0952 |
| Weighted residual factors for all reflections included in the refinement |
0.0994 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.048 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230236.html