Information card for entry 2230254
| Common name |
2,5-Bis[4-(dimethylamino)phenyl]-3,6-dimethylpyrazine |
| Chemical name |
4-{5-[4-(dimethylamino)phenyl]-3,6-dimethylpyrazin-2-yl}- <i>N</i>,<i>N</i>-dimethylaniline |
| Formula |
C22 H26 N4 |
| Calculated formula |
C22 H26 N4 |
| SMILES |
c1(nc(c(nc1C)c1ccc(cc1)N(C)C)C)c1ccc(cc1)N(C)C |
| Title of publication |
2,5-Bis[4-(dimethylamino)phenyl]-3,6-dimethylpyrazine |
| Authors of publication |
Moschel, Sebastian; Schollmeyer, Dieter; Detert, Heiner |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
6 |
| Pages of publication |
o1425 |
| a |
9.459 ± 0.001 Å |
| b |
9.6368 ± 0.0016 Å |
| c |
11.9661 ± 0.0015 Å |
| α |
73.3 ± 0.01° |
| β |
69.465 ± 0.011° |
| γ |
74.446 ± 0.01° |
| Cell volume |
961.2 ± 0.2 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0781 |
| Residual factor for significantly intense reflections |
0.0627 |
| Weighted residual factors for significantly intense reflections |
0.1858 |
| Weighted residual factors for all reflections included in the refinement |
0.2184 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.074 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230254.html