Information card for entry 2230327
| Common name |
TIQester |
| Chemical name |
(1<i>S</i>,3<i>S</i>)-Methyl 2-benzyl-6,7-dimethoxy- 1-phenyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylate |
| Formula |
C26 H27 N O4 |
| Calculated formula |
C26 H27 N O4 |
| SMILES |
O(c1cc2[C@@H](N([C@@H](Cc2cc1OC)C(=O)OC)Cc1ccccc1)c1ccccc1)C |
| Title of publication |
(1<i>S</i>,3<i>S</i>)-Methyl 2-benzyl-6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylate |
| Authors of publication |
Naicker, Tricia; Govender, Thavendran; Kruger, Hendrik. G.; Maguire, Glenn. E. M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
6 |
| Pages of publication |
o1403 |
| a |
9.7797 ± 0.0007 Å |
| b |
5.4646 ± 0.0004 Å |
| c |
20.6959 ± 0.0015 Å |
| α |
90° |
| β |
96.986 ± 0.001° |
| γ |
90° |
| Cell volume |
1097.82 ± 0.14 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0358 |
| Residual factor for significantly intense reflections |
0.0314 |
| Weighted residual factors for significantly intense reflections |
0.0832 |
| Weighted residual factors for all reflections included in the refinement |
0.0866 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.047 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230327.html