Information card for entry 2230402
| Chemical name |
<i>N</i>-(5-Ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4,5,6,7- tetrahydrothieno[3,2-<i>c</i>]pyridin-5-yl)acetamide |
| Formula |
C13 H16 N4 O S3 |
| Calculated formula |
C13 H16 N4 O S3 |
| SMILES |
s1c2CCN(Cc2cc1)CC(=O)Nc1sc(SCC)nn1 |
| Title of publication |
<i>N</i>-(5-Ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4,5,6,7-tetrahydrothieno[3,2-<i>c</i>]pyridin-5-yl)acetamide |
| Authors of publication |
Zhi, Shuang; Mu, Shuai; Liu, Ying; Liu, Deng-Ke |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
6 |
| Pages of publication |
o1490 |
| a |
6.532 ± 0.004 Å |
| b |
9.788 ± 0.006 Å |
| c |
23.491 ± 0.015 Å |
| α |
90° |
| β |
95.524 ± 0.006° |
| γ |
90° |
| Cell volume |
1494.9 ± 1.6 Å3 |
| Cell temperature |
113 ± 2 K |
| Ambient diffraction temperature |
113 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.038 |
| Residual factor for significantly intense reflections |
0.0296 |
| Weighted residual factors for significantly intense reflections |
0.0764 |
| Weighted residual factors for all reflections included in the refinement |
0.0788 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.025 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230402.html