Information card for entry 2230532
| Common name |
Rauniticine-<i>allo</i>-oxindole B methanol monosolvate |
| Chemical name |
2-oxo-1,2,2',3',5',5'a,6',9'a,10',10'a-decahydrospiro[indole-3,1'- pyrano[3,4-<i>f</i>]indolizine]-9'-carboxylic acid methanol monosolvate |
| Formula |
C21 H26 N2 O5 |
| Calculated formula |
C21 H26 N2 O5 |
| SMILES |
OC(=O)C1=CO[C@@H](C)[C@@H]2CN3[C@@H](C[C@H]12)[C@]1(CC3)C(=O)Nc2ccccc12.OC |
| Title of publication |
Rauniticine-<i>allo</i>-oxindole B methanol monosolvate |
| Authors of publication |
Salim, Fatimah; Ahmad, Rohaya; Ismail, Nor Hadiani; Hazni, Hazrina; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
6 |
| Pages of publication |
o1345 |
| a |
9.233 ± 0.0003 Å |
| b |
7.211 ± 0.0002 Å |
| c |
14.7678 ± 0.0004 Å |
| α |
90° |
| β |
99.313 ± 0.003° |
| γ |
90° |
| Cell volume |
970.27 ± 0.05 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0435 |
| Residual factor for significantly intense reflections |
0.0374 |
| Weighted residual factors for significantly intense reflections |
0.0882 |
| Weighted residual factors for all reflections included in the refinement |
0.0927 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.048 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230532.html