Information card for entry 2230639
| Chemical name |
1-[2,2-Bis(1,3-benzimidazol-1-ylmethyl)-3-bromopropyl]-1,3-benzimidazole |
| Formula |
C26 H23 Br N6 |
| Calculated formula |
C26 H23 Br N6 |
| SMILES |
BrCC(Cn1c2c(nc1)cccc2)(Cn1c2c(cccc2)nc1)Cn1c2ccccc2nc1 |
| Title of publication |
1-[2,2-Bis(1,3-benzimidazol-1-ylmethyl)-3-bromopropyl]-1,3-benzimidazole |
| Authors of publication |
Wei, Tai-Bao; Lu, Yan-Yun; Cao, Cheng; Yao, Hong; Zhang, You-Ming |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
7 |
| Pages of publication |
o1833 |
| a |
9.297 ± 0.004 Å |
| b |
11.869 ± 0.005 Å |
| c |
13.661 ± 0.006 Å |
| α |
68.956 ± 0.004° |
| β |
77.398 ± 0.004° |
| γ |
84.805 ± 0.004° |
| Cell volume |
1372.9 ± 1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0588 |
| Residual factor for significantly intense reflections |
0.0366 |
| Weighted residual factors for significantly intense reflections |
0.0812 |
| Weighted residual factors for all reflections included in the refinement |
0.0855 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.012 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230639.html