Information card for entry 2230709
| Chemical name |
<i>catena</i>-Poly[[(2,2'-dimethyl-4,4'-bi-1,3-thiazole- κ^2^<i>N</i>,<i>N</i>')cadmium]-di-μ-bromido] |
| Formula |
C8 H8 Br2 Cd N2 S2 |
| Calculated formula |
C8 H8 Br2 Cd N2 S2 |
| SMILES |
[Cd]12([n]3c(C)scc3c3csc(C)[n]13)[Br][Cd]1([n]3c(C)scc3c3csc(C)[n]13)(Br)(Br)[Br]2 |
| Title of publication |
<i>catena</i>-Poly[[(2,2'-dimethyl-4,4'-bi-1,3-thiazole-κ^2^<i>N</i>,<i>N</i>')cadmium]-di-μ-bromido] |
| Authors of publication |
Abedi, Anita; Rezaei, Forugh |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
7 |
| Pages of publication |
m886 |
| a |
7.1936 ± 0.001 Å |
| b |
9.5775 ± 0.0011 Å |
| c |
10.4218 ± 0.0014 Å |
| α |
112.714 ± 0.009° |
| β |
104.149 ± 0.011° |
| γ |
92.68 ± 0.01° |
| Cell volume |
634.2 ± 0.16 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.101 |
| Residual factor for significantly intense reflections |
0.0812 |
| Weighted residual factors for significantly intense reflections |
0.2145 |
| Weighted residual factors for all reflections included in the refinement |
0.232 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.053 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230709.html