Information card for entry 2230852
| Chemical name |
2-[(<i>E</i>)-(2,4-Dichlorobenzylidene)amino]isoindoline-1,3-dione |
| Formula |
C15 H8 Cl2 N2 O2 |
| Calculated formula |
C15 H8 Cl2 N2 O2 |
| SMILES |
Clc1cc(Cl)ccc1/C=N/N1C(=O)c2ccccc2C1=O |
| Title of publication |
2-[(<i>E</i>)-(2,4-Dichlorobenzylidene)amino]isoindoline-1,3-dione |
| Authors of publication |
Asad, Mohammad; Oo, Chuan-Wei; Osman, Hasnah; Hemamalini, Madhukar; Fun, Hoong-Kun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
7 |
| Pages of publication |
o1712 |
| a |
8.0387 ± 0.0008 Å |
| b |
7.6981 ± 0.0008 Å |
| c |
22.2686 ± 0.0019 Å |
| α |
90° |
| β |
101.828 ± 0.003° |
| γ |
90° |
| Cell volume |
1348.8 ± 0.2 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.075 |
| Residual factor for significantly intense reflections |
0.0464 |
| Weighted residual factors for significantly intense reflections |
0.0985 |
| Weighted residual factors for all reflections included in the refinement |
0.1131 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.07 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230852.html