Information card for entry 2230888
| Chemical name |
Benzene-1,3,5-tricarboxylic acid–5-(pyridin-1-ium-3-yl)-5<i>H</i>-1,2,3,4-tetrazol-5-ide (1/1) |
| Formula |
C15 H11 N5 O6 |
| Calculated formula |
C15 H11 N5 O6 |
| SMILES |
c1(c[nH+]ccc1)c1n[n-]nn1.c1(cc(cc(c1)C(=O)O)C(=O)O)C(=O)O |
| Title of publication |
Benzene-1,3,5-tricarboxylic acid–5-(pyridin-1-ium-3-yl)-5<i>H</i>-1,2,3,4-tetrazol-5-ide (1/1) |
| Authors of publication |
Meng, Gao-Xiang; Ding, Hao; Feng, Ya-Min; Zhu, Jian-Hui; Yang, He-Lin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
7 |
| Pages of publication |
o1620 |
| a |
7.6596 ± 0.0008 Å |
| b |
8.7374 ± 0.0009 Å |
| c |
11.3931 ± 0.0011 Å |
| α |
94.336 ± 0.002° |
| β |
95.584 ± 0.001° |
| γ |
98.465 ± 0.002° |
| Cell volume |
747.46 ± 0.13 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0776 |
| Residual factor for significantly intense reflections |
0.0675 |
| Weighted residual factors for significantly intense reflections |
0.1345 |
| Weighted residual factors for all reflections included in the refinement |
0.1389 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.239 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
Mokα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230888.html