Information card for entry 2230999
| Chemical name |
2,3-Bis(ethylsulfanyl)-1,4,5,8-tetrathiafulvalene-6,7-dicarbonitrile |
| Formula |
C12 H10 N2 S6 |
| Calculated formula |
C12 H10 N2 S6 |
| SMILES |
C(#N)C1=C(C#N)SC(=C2SC(=C(S2)SCC)SCC)S1 |
| Title of publication |
2,3-Bis(ethylsulfanyl)-1,4,5,8-tetrathiafulvalene-6,7-dicarbonitrile |
| Authors of publication |
Hou, Rui-bin; Li, Dong-feng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
8 |
| Pages of publication |
o2096 |
| a |
7.8357 ± 0.0016 Å |
| b |
8.9777 ± 0.0018 Å |
| c |
12.618 ± 0.003 Å |
| α |
76.48 ± 0.03° |
| β |
77.59 ± 0.03° |
| γ |
73.2 ± 0.03° |
| Cell volume |
815.8 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0375 |
| Residual factor for significantly intense reflections |
0.031 |
| Weighted residual factors for significantly intense reflections |
0.0998 |
| Weighted residual factors for all reflections included in the refinement |
0.1085 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.151 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230999.html