Information card for entry 2231128
| Chemical name |
(<i>E</i>)-4-Chloro-<i>N</i>-(2,4,6-trimethylbenzylidene)aniline |
| Formula |
C16 H16 Cl N |
| Calculated formula |
C16 H16 Cl N |
| SMILES |
c1(cc(cc(c1/C=N/c1ccc(cc1)Cl)C)C)C |
| Title of publication |
(<i>E</i>)-4-Chloro-<i>N</i>-(2,4,6-trimethylbenzylidene)aniline |
| Authors of publication |
Guo, Ying; Pan, Meng-Xin; Xiang, Hai; Liu, Wen-Hong; Song, Zhong-Cheng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
8 |
| Pages of publication |
o1999 |
| a |
7.198 ± 0.002 Å |
| b |
12.398 ± 0.004 Å |
| c |
15.865 ± 0.005 Å |
| α |
90° |
| β |
102.296 ± 0.004° |
| γ |
90° |
| Cell volume |
1383.3 ± 0.7 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0843 |
| Residual factor for significantly intense reflections |
0.0459 |
| Weighted residual factors for significantly intense reflections |
0.1079 |
| Weighted residual factors for all reflections included in the refinement |
0.1358 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.041 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231128.html