Information card for entry 2231158
| Chemical name |
3,5-Bis(4-methoxyphenyl)-4,5-dihydroisoxazole |
| Formula |
C17 H17 N O3 |
| Calculated formula |
C17 H17 N O3 |
| SMILES |
O1N=C(c2ccc(OC)cc2)CC1c1ccc(OC)cc1 |
| Title of publication |
3,5-Bis(4-methoxyphenyl)-4,5-dihydroisoxazole |
| Authors of publication |
Samshuddin, S.; Butcher, Ray J.; Akkurt, Mehmet; Narayana, B.; Yathirajan, H. S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
8 |
| Pages of publication |
o1975 - o1976 |
| a |
10.5071 ± 0.0007 Å |
| b |
8.4023 ± 0.0005 Å |
| c |
32.6662 ± 0.0019 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2883.9 ± 0.3 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.1364 |
| Residual factor for significantly intense reflections |
0.0745 |
| Weighted residual factors for significantly intense reflections |
0.1319 |
| Weighted residual factors for all reflections included in the refinement |
0.1559 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.059 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231158.html