Information card for entry 2231201
| Chemical name |
2,2-Dichloro-1-(3,3,6-trimethyl-9-oxo-1,5-diazabicyclo[4.3.0]nonan-5-yl)ethanone |
| Formula |
C12 H18 Cl2 N2 O2 |
| Calculated formula |
C12 H18 Cl2 N2 O2 |
| SMILES |
ClC(Cl)C(=O)N1CC(C)(C)CN2C1(C)CCC2=O |
| Title of publication |
2,2-Dichloro-1-(3,3,6-trimethyl-9-oxo-1,5-diazabicyclo[4.3.0]nonan-5-yl)ethanone |
| Authors of publication |
Fu, Ying; Ye, Fei |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
8 |
| Pages of publication |
o2020 |
| a |
9.4442 ± 0.0018 Å |
| b |
14.116 ± 0.003 Å |
| c |
11.7555 ± 0.0016 Å |
| α |
90° |
| β |
115.067 ± 0.011° |
| γ |
90° |
| Cell volume |
1419.6 ± 0.5 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0649 |
| Residual factor for significantly intense reflections |
0.0443 |
| Weighted residual factors for significantly intense reflections |
0.1138 |
| Weighted residual factors for all reflections included in the refinement |
0.1288 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.035 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231201.html