Information card for entry 2231226
| Chemical name |
1,5-Anhydro-2-deoxy-1,2-<i>C</i>-dichloromethylene-3,4,6-tri-<i>O</i>-\ (4-methoxybenzyl)-D-<i>glycero</i>-D-<i>gulo</i>-hexitol |
| Formula |
C31 H34 Cl2 O7 |
| Calculated formula |
C31 H34 Cl2 O7 |
| SMILES |
[C@H]1([C@H]([C@@H]([C@@H]2[C@@H](C2(Cl)Cl)O1)OCc1ccc(cc1)OC)OCc1ccc(cc1)OC)COCc1ccc(cc1)OC |
| Title of publication |
1,5-Anhydro-2-deoxy-1,2-<i>C</i>-dichloromethylene-3,4,6-tri-<i>O</i>-(4-methoxybenzyl)-<small>D</small>-<i>glycero</i>-<small>D</small>-<i>gulo</i>-hexitol |
| Authors of publication |
Kinfe, Henok H.; Moshapo, Paseka T.; Muller, Alfred |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
8 |
| Pages of publication |
o2012 - o2013 |
| a |
5.348 ± 0.0004 Å |
| b |
18.111 ± 0.0014 Å |
| c |
14.823 ± 0.0011 Å |
| α |
90° |
| β |
91.162 ± 0.002° |
| γ |
90° |
| Cell volume |
1435.43 ± 0.19 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0236 |
| Residual factor for significantly intense reflections |
0.0233 |
| Weighted residual factors for all reflections included in the refinement |
0.0622 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.039 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231226.html