Information card for entry 2231235
| Chemical name |
3,8-Dimethylquinazoline-2,4(1<i>H</i>,3<i>H</i>)-dione |
| Formula |
C10 H10 N2 O2 |
| Calculated formula |
C10 H10 N2 O2 |
| SMILES |
c12c(cccc1C(=O)N(C(=O)N2)C)C |
| Title of publication |
3,8-Dimethylquinazoline-2,4(1<i>H</i>,3<i>H</i>)-dione |
| Authors of publication |
Qin, Wei-Yan; Liu, Bo; Duan, Cong-Wen; Yin, Qing-Xiu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
8 |
| Pages of publication |
o1927 |
| a |
8.3604 ± 0.0017 Å |
| b |
4.8599 ± 0.001 Å |
| c |
22.288 ± 0.005 Å |
| α |
90° |
| β |
92.09 ± 0.03° |
| γ |
90° |
| Cell volume |
905 ± 0.3 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0577 |
| Residual factor for significantly intense reflections |
0.0429 |
| Weighted residual factors for significantly intense reflections |
0.1346 |
| Weighted residual factors for all reflections included in the refinement |
0.1429 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.102 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231235.html