Information card for entry 2231256
| Chemical name |
Aqua(4-carboxypyridine-2,6-dicarboxylato- κ^3^<i>O</i>^2^,<i>N</i>,<i>O</i>^6^)(1,10-phenanthroline- κ^2^<i>N</i>,<i>N</i>')nickel(II) |
| Formula |
C20 H13 N3 Ni O7 |
| Calculated formula |
C20 H13 N3 Ni O7 |
| SMILES |
[Ni]123([n]4c(cc(cc4C(=O)O2)C(=O)O)C(=O)O1)([n]1cccc2ccc4ccc[n]3c4c12)[OH2] |
| Title of publication |
Aqua(4-carboxypyridine-2,6-dicarboxylato-κ^3^<i>O</i>^2^,<i>N</i>,<i>O</i>^6^)(1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')nickel(II) |
| Authors of publication |
Zou, Qin; Wang, Jian-fei; Lin, Jian-li |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
8 |
| Pages of publication |
m1043 |
| a |
6.8387 ± 0.0014 Å |
| b |
13.421 ± 0.003 Å |
| c |
19.676 ± 0.004 Å |
| α |
90° |
| β |
91.87 ± 0.03° |
| γ |
90° |
| Cell volume |
1804.9 ± 0.7 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1022 |
| Residual factor for significantly intense reflections |
0.0443 |
| Weighted residual factors for significantly intense reflections |
0.0835 |
| Weighted residual factors for all reflections included in the refinement |
0.1417 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.192 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231256.html