Information card for entry 2231328
| Common name |
Bis(2-hydroxybenzophenone)-2,2'-dimethylpropanediimine copper(II) |
| Chemical name |
{2,2'-[(2,2-Dimethylpropane-1,3- diyldinitrilo)bis(phenylmethylidyne)]diphenolato}copper(II) |
| Formula |
C31 H28 Cu N2 O2 |
| Calculated formula |
C31 H28 Cu N2 O2 |
| SMILES |
c12ccccc1C(=[N]1[Cu]3(O2)[N](=C(c2c(cccc2)O3)c2ccccc2)CC(C1)(C)C)c1ccccc1 |
| Title of publication |
{2,2'-[(2,2-Dimethylpropane-1,3-diyldinitrilo)bis(phenylmethylidyne)]diphenolato}copper(II) |
| Authors of publication |
Kargar, Hadi; Kia, Reza; Moghadam, Majid; Froozandeh, Fatemeh; Tahir, Muhammad Nawaz |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
8 |
| Pages of publication |
m1145 |
| a |
9.7435 ± 0.0014 Å |
| b |
9.7435 ± 0.0014 Å |
| c |
25.717 ± 0.006 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2441.5 ± 0.8 Å3 |
| Cell temperature |
291 ± 2 K |
| Ambient diffraction temperature |
291 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
92 |
| Hermann-Mauguin space group symbol |
P 41 21 2 |
| Hall space group symbol |
P 4abw 2nw |
| Residual factor for all reflections |
0.1324 |
| Residual factor for significantly intense reflections |
0.0698 |
| Weighted residual factors for significantly intense reflections |
0.0537 |
| Weighted residual factors for all reflections included in the refinement |
0.064 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.84 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231328.html