Information card for entry 2231374
| Common name |
chalcone |
| Chemical name |
(<i>E</i>)-1-(4-Methoxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| Formula |
C19 H20 O5 |
| Calculated formula |
C19 H20 O5 |
| SMILES |
COc1ccc(cc1)C(=O)/C=C/c1cc(OC)c(c(c1)OC)OC |
| Title of publication |
(<i>E</i>)-1-(4-Methoxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| Authors of publication |
Carvalho-Jr, P. S.; Sallum, L. O.; Cidade, A. F.; Aquino, G. L. B.; Napolitano, H. B. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
8 |
| Pages of publication |
o2126 |
| a |
7.577 ± 0.0001 Å |
| b |
16.253 ± 0.0003 Å |
| c |
14.085 ± 0.0003 Å |
| α |
90° |
| β |
107.528 ± 0.001° |
| γ |
90° |
| Cell volume |
1654.02 ± 0.05 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0705 |
| Residual factor for significantly intense reflections |
0.0559 |
| Weighted residual factors for all reflections included in the refinement |
0.1744 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.018 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231374.html