Information card for entry 2231542
| Chemical name |
3-Amino-1-(4-methoxyphenyl)-9,10-dihydrophenanthrene-2,4-dicarbonitrile |
| Formula |
C23 H17 N3 O |
| Calculated formula |
C23 H17 N3 O |
| SMILES |
O(c1ccc(c2c(c(N)c(c3c2CCc2ccccc32)C#N)C#N)cc1)C |
| Title of publication |
3-Amino-1-(4-methoxyphenyl)-9,10-dihydrophenanthrene-2,4-dicarbonitrile |
| Authors of publication |
Asiri, Abdullah M.; Al-Youbi, Abdulrahman O.; Faidallah, Hassan M.; Ng, Seik Weng; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
9 |
| Pages of publication |
o2449 |
| a |
9.0212 ± 0.0004 Å |
| b |
22.1475 ± 0.0008 Å |
| c |
9.3114 ± 0.0004 Å |
| α |
90° |
| β |
110.41 ± 0.005° |
| γ |
90° |
| Cell volume |
1743.6 ± 0.14 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0679 |
| Residual factor for significantly intense reflections |
0.0483 |
| Weighted residual factors for significantly intense reflections |
0.1042 |
| Weighted residual factors for all reflections included in the refinement |
0.1161 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.038 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231542.html