Information card for entry 2231563
| Chemical name |
2,4-Dioxo-1-(prop-2-ynyl)-1,2,3,4-tetrahydropyrimidine-5-carbaldehyde |
| Formula |
C8 H6 N2 O3 |
| Calculated formula |
C8 H6 N2 O3 |
| SMILES |
C1(=O)C(=CN(C(=O)N1)CC#C)C=O |
| Title of publication |
2,4-Dioxo-1-(prop-2-ynyl)-1,2,3,4-tetrahydropyrimidine-5-carbaldehyde |
| Authors of publication |
He, Yan; Cui, Liang-Yan; Zhang, Xin-Ying |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
9 |
| Pages of publication |
o2350 |
| a |
5.1756 ± 0.0007 Å |
| b |
8.4877 ± 0.0012 Å |
| c |
18.565 ± 0.003 Å |
| α |
90° |
| β |
90.611 ± 0.002° |
| γ |
90° |
| Cell volume |
815.5 ± 0.2 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.048 |
| Residual factor for significantly intense reflections |
0.04 |
| Weighted residual factors for significantly intense reflections |
0.1163 |
| Weighted residual factors for all reflections included in the refinement |
0.1231 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.076 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231563.html