Information card for entry 2231624
| Chemical name |
3,3'-Dimethyl-1,1'-[2,2'-bipyridine-5,5'-diylbis(methylene)]diimidazol-3-ium bis(hexafluorophosphate) |
| Formula |
C20 H22 F12 N6 P2 |
| Calculated formula |
C20 H22 F12 N6 P2 |
| SMILES |
c1c(ccc(n1)c1ccc(cn1)Cn1c[n+](cc1)C)Cn1c[n+](cc1)C.[P](F)(F)(F)(F)(F)[F-].[P](F)(F)(F)(F)(F)[F-] |
| Title of publication |
3,3'-Dimethyl-1,1'-[2,2'-bipyridine-5,5'-diylbis(methylene)]diimidazol-3-ium bis(hexafluorophosphate) |
| Authors of publication |
Park, Sunhong; Moon, Suk-Hee; Kim, Tae Ho; Park, Ki-Min |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
9 |
| Pages of publication |
o2392 |
| a |
7.5323 ± 0.0004 Å |
| b |
10.7169 ± 0.0006 Å |
| c |
15.4602 ± 0.0009 Å |
| α |
90° |
| β |
93.922 ± 0.001° |
| γ |
90° |
| Cell volume |
1245.07 ± 0.12 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0734 |
| Residual factor for significantly intense reflections |
0.0395 |
| Weighted residual factors for significantly intense reflections |
0.0986 |
| Weighted residual factors for all reflections included in the refinement |
0.1165 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.02 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231624.html