Information card for entry 2231635
| Chemical name |
<i>cis</i>-[1,2-Bis(diphenylarsanyl)ethane- κ^2^<i>As</i>,<i>As</i>']tetracarbonylchromium(0) |
| Formula |
C30 H24 As2 Cr O4 |
| Calculated formula |
C30 H24 As2 Cr O4 |
| SMILES |
[As]1([Cr]([As](CC1)(c1ccccc1)c1ccccc1)(C#[O])(C#[O])(C#[O])C#[O])(c1ccccc1)c1ccccc1 |
| Title of publication |
<i>cis</i>-[1,2-Bis(diphenylarsanyl)ethane-κ^2^<i>As</i>,<i>As</i>']tetracarbonylchromium(0) |
| Authors of publication |
Norlidah, M. N.; Azhar, M. Y.; Bin Shawkataly, Omar; Rosli, Mohd Mustaqim; Fun, Hoong-Kun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
9 |
| Pages of publication |
m1267 - m1268 |
| a |
17.0231 ± 0.0004 Å |
| b |
12.62 ± 0.0003 Å |
| c |
25.5527 ± 0.0006 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
5489.5 ± 0.2 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
5 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0443 |
| Residual factor for significantly intense reflections |
0.0279 |
| Weighted residual factors for significantly intense reflections |
0.0581 |
| Weighted residual factors for all reflections included in the refinement |
0.0645 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.018 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231635.html