Information card for entry 2231639
| Chemical name |
2-(5-{6-[5-(Pyrazin-2-yl)-1<i>H</i>-1,2,4-triazol-3-yl]pyridin-2-yl}-1<i>H</i>- 1,2,4-triazol-3-yl)pyrazine |
| Formula |
C17 H11 N11 |
| Calculated formula |
C17 H11 N11 |
| SMILES |
n1c(c2cnccn2)n[nH]c1c1nc(c2nc([nH]n2)c2nccnc2)ccc1 |
| Title of publication |
2-(5-{6-[5-(Pyrazin-2-yl)-1<i>H</i>-1,2,4-triazol-3-yl]pyridin-2-yl}-1<i>H</i>-1,2,4-triazol-3-yl)pyrazine |
| Authors of publication |
Xu, Zhouqing; Sun, Yanchun; Wang, Qiang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
9 |
| Pages of publication |
o2457 |
| a |
10.751 ± 0.002 Å |
| b |
13.721 ± 0.003 Å |
| c |
11.385 ± 0.002 Å |
| α |
90° |
| β |
102.57 ± 0.03° |
| γ |
90° |
| Cell volume |
1639.2 ± 0.6 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.073 |
| Residual factor for significantly intense reflections |
0.0635 |
| Weighted residual factors for significantly intense reflections |
0.1199 |
| Weighted residual factors for all reflections included in the refinement |
0.1247 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.221 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231639.html