Information card for entry 2231698
| Chemical name |
2-[(<i>E</i>)-(6-Amino-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)iminomethyl]pyridinium bromide |
| Formula |
C12 H14 Br N5 O2 |
| Calculated formula |
C12 H14 Br N5 O2 |
| SMILES |
O=C1N(C(N)=C(/N=C/c2[nH+]cccc2)C(=O)N1C)C.[Br-] |
| Title of publication |
2-[(<i>E</i>)-(6-Amino-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)iminomethyl]pyridinium bromide |
| Authors of publication |
Booysen, Irvin; Ismail, Muhammed; Gerber, Thomas; Hosten, Eric; Betz, Richard |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
9 |
| Pages of publication |
o2387 - o2388 |
| a |
8.952 ± 0.0002 Å |
| b |
4.963 ± 0.0001 Å |
| c |
30.9123 ± 0.0006 Å |
| α |
90° |
| β |
105.391 ± 0.001° |
| γ |
90° |
| Cell volume |
1324.14 ± 0.05 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0326 |
| Residual factor for significantly intense reflections |
0.0288 |
| Weighted residual factors for significantly intense reflections |
0.0663 |
| Weighted residual factors for all reflections included in the refinement |
0.0676 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.161 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231698.html