Information card for entry 2231741
| Chemical name |
4-(3,7-Dimethyl-4-oxo-4,5- dihydroisoxazolo[4,5-<i>d</i>]pyridazin-5-yl)benzenesulfonamide |
| Formula |
C13 H12 N4 O4 S |
| Calculated formula |
C13 H12 N4 O4 S |
| SMILES |
S(=O)(=O)(N)c1ccc(n2nc(C)c3onc(c3c2=O)C)cc1 |
| Title of publication |
4-(3,7-Dimethyl-4-oxo-4,5-dihydroisoxazolo[4,5-<i>d</i>]pyridazin-5-yl)benzenesulfonamide |
| Authors of publication |
Asiri, Abdullah M.; Faidallah, Hassan M.; Al-Youbi, Abdulrahman O.; Obaid, Abdullah.Y.; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
9 |
| Pages of publication |
o2466 |
| a |
18.0113 ± 0.0004 Å |
| b |
35.5302 ± 0.0011 Å |
| c |
8.29 ± 0.0002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
5305.1 ± 0.2 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
43 |
| Hermann-Mauguin space group symbol |
F d d 2 |
| Hall space group symbol |
F 2 -2d |
| Residual factor for all reflections |
0.0332 |
| Residual factor for significantly intense reflections |
0.033 |
| Weighted residual factors for significantly intense reflections |
0.0961 |
| Weighted residual factors for all reflections included in the refinement |
0.0964 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.078 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231741.html