Information card for entry 2231823
| Chemical name |
1,4-Dimethyl-2-phenyl-6,7-dihydro-1<i>H</i>-pyrazolo[4,3-<i>b</i>]pyridine- 3,5(2<i>H</i>,4<i>H</i>)-dione |
| Formula |
C14 H15 N3 O2 |
| Calculated formula |
C14 H15 N3 O2 |
| SMILES |
N1(C(=O)C2=C(N1C)CCC(=O)N2C)c1ccccc1 |
| Title of publication |
1,4-Dimethyl-2-phenyl-6,7-dihydro-1<i>H</i>-pyrazolo[4,3-<i>b</i>]pyridine-3,5(2<i>H</i>,4<i>H</i>)-dione |
| Authors of publication |
Weisser, Marc; Schollmeyer, Dieter; Laufer, Stefan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
10 |
| Pages of publication |
o2586 |
| a |
8.9721 ± 0.0007 Å |
| b |
21.7653 ± 0.0019 Å |
| c |
7.3725 ± 0.0005 Å |
| α |
90° |
| β |
120.214 ± 0.005° |
| γ |
90° |
| Cell volume |
1244.12 ± 0.18 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
9 |
| Hermann-Mauguin space group symbol |
C 1 c 1 |
| Hall space group symbol |
C -2yc |
| Residual factor for all reflections |
0.0294 |
| Residual factor for significantly intense reflections |
0.0273 |
| Weighted residual factors for significantly intense reflections |
0.0696 |
| Weighted residual factors for all reflections included in the refinement |
0.0707 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.042 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231823.html