Information card for entry 2232009
| Chemical name |
Di-<i>n</i>-propyl 4,4'-dihydroxy-3,3'-{[(3a<i>RS</i>,7a<i>RS</i>)-2,3,3a,4,5,6,7,7a-octahydro -1<i>H</i>-benzimidazole-1,3-diyl]bis(methylene)}dibenzoate |
| Formula |
C29 H38 N2 O6 |
| Calculated formula |
C29 H38 N2 O6 |
| SMILES |
CCCOC(=O)c1ccc(c(c1)CN1CN([C@H]2[C@H]1CCCC2)Cc1cc(ccc1O)C(=O)OCCC)O.CCCOC(=O)c1ccc(c(c1)CN1CN([C@@H]2[C@@H]1CCCC2)Cc1cc(ccc1O)C(=O)OCCC)O |
| Title of publication |
Di-<i>n</i>-propyl 4,4'-dihydroxy-3,3'-{[(3a<i>RS</i>,7a<i>RS</i>)-2,3,3a,4,5,6,7,7a-octahydro-1<i>H</i>-benzimidazole-1,3-diyl]bis(methylene)}dibenzoate |
| Authors of publication |
Rivera, Augusto; Quiroga, Diego; Ríos-Motta, Jaime; Fejfarová, Karla; Dušek, Michal |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
10 |
| Pages of publication |
o2627 - o2628 |
| a |
15.8047 ± 0.0004 Å |
| b |
8.7762 ± 0.0003 Å |
| c |
19.0108 ± 0.0006 Å |
| α |
90° |
| β |
96.353 ± 0.002° |
| γ |
90° |
| Cell volume |
2620.7 ± 0.14 Å3 |
| Cell temperature |
120 K |
| Ambient diffraction temperature |
120 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0524 |
| Residual factor for significantly intense reflections |
0.0394 |
| Weighted residual factors for significantly intense reflections |
0.0982 |
| Weighted residual factors for all reflections included in the refinement |
0.1049 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.57 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232009.html