Information card for entry 2232051
| Chemical name |
(<i>E</i>)-1-(1-Benzyl-5-methyl-1<i>H</i>-1,2,3-triazol-4-yl)-3-(4-fluorophenyl)prop-2-en-1-one |
| Formula |
C19 H16 F N3 O |
| Calculated formula |
C19 H16 F N3 O |
| SMILES |
Fc1ccc(cc1)/C=C/C(=O)c1nnn(c1C)Cc1ccccc1 |
| Title of publication |
(<i>E</i>)-1-(1-Benzyl-5-methyl-1<i>H</i>-1,2,3-triazol-4-yl)-3-(4-fluorophenyl)prop-2-en-1-one |
| Authors of publication |
Fun, Hoong-Kun; Hemamalini, Madhukar; Shanmugavelan, Poovan; Ponnuswamy, Alagusundaram; Jagatheesan, Rathinavel |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
10 |
| Pages of publication |
o2776 |
| a |
12.458 ± 0.001 Å |
| b |
13.7528 ± 0.0011 Å |
| c |
19.3128 ± 0.0015 Å |
| α |
90° |
| β |
100.183 ± 0.002° |
| γ |
90° |
| Cell volume |
3256.8 ± 0.4 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1152 |
| Residual factor for significantly intense reflections |
0.0487 |
| Weighted residual factors for significantly intense reflections |
0.1243 |
| Weighted residual factors for all reflections included in the refinement |
0.1577 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.988 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232051.html