Information card for entry 2232509
| Chemical name |
6-Benzyl-6,7-dihydro-5<i>H</i>-pyrrolo[3,4-<i>b</i>]pyridine-5,7-dione |
| Formula |
C14 H10 N2 O2 |
| Calculated formula |
C14 H10 N2 O2 |
| SMILES |
N1(Cc2ccccc2)C(=O)c2cccnc2C1=O |
| Title of publication |
6-Benzyl-6,7-dihydro-5<i>H</i>-pyrrolo[3,4-<i>b</i>]pyridine-5,7-dione |
| Authors of publication |
Sun, Hong-Shun; Jiang, Long; Xu, Hong; Lu, Xin-Hua; Li, Yu-Long |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
11 |
| Pages of publication |
o2895 |
| a |
11.8548 ± 0.0006 Å |
| b |
12.3969 ± 0.0008 Å |
| c |
8.1676 ± 0.0004 Å |
| α |
90° |
| β |
107.45 ± 0.03° |
| γ |
90° |
| Cell volume |
1145.1 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1152 |
| Residual factor for significantly intense reflections |
0.0582 |
| Weighted residual factors for significantly intense reflections |
0.1457 |
| Weighted residual factors for all reflections included in the refinement |
0.1736 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.004 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232509.html