Information card for entry 2232539
| Chemical name |
2-Amino-4-(3,4-dimethoxyphenyl)-5,6-dihydrobenzo[<i>h</i>]quinoline-3- carbonitrile–3-amino-1-(3,4-dimethoxyphenyl)-9,10-dihydrophenanthrene-2,4- dicarbonitrile (1/19) |
| Formula |
C23.9 H19 N3 O2 |
| Calculated formula |
C23.9 H19 N3 O2 |
| SMILES |
N#Cc1c(c2ccc(c(c2)OC)OC)c2CCc3c(c2c(c1N)C#N)cccc3 |
| Title of publication |
2-Amino-4-(3,4-dimethoxyphenyl)-5,6-dihydrobenzo[<i>h</i>]quinoline-3-carbonitrile–3-amino-1-(3,4-dimethoxyphenyl)-9,10-dihydrophenanthrene-2,4-dicarbonitrile (1/19) |
| Authors of publication |
Asiri, Abdullah M.; Al-Youbi, Abdulrahman O.; Faidallah, Hassan M.; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
11 |
| Pages of publication |
o2873 |
| a |
8.9347 ± 0.0003 Å |
| b |
14.4915 ± 0.0005 Å |
| c |
14.7818 ± 0.0006 Å |
| α |
90° |
| β |
103.446 ± 0.004° |
| γ |
90° |
| Cell volume |
1861.45 ± 0.12 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0711 |
| Residual factor for significantly intense reflections |
0.049 |
| Weighted residual factors for significantly intense reflections |
0.1097 |
| Weighted residual factors for all reflections included in the refinement |
0.124 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.035 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232539.html