Information card for entry 2232542
| Common name |
tuberostemoamide hemihydrate |
| Chemical name |
(1'<i>S</i>,2<i>R</i>,2'<i>R</i>,3'<i>S</i>,6'<i>R</i>)-3'-ethyl-4-methyl- 5<i>H</i>-5'-oxa-10'-azaspiro[furan-2,4'-tricyclo[8.3.0.0^2,6^]tridecane]- 5,11'-dione hemihydrate |
| Formula |
C17 H24 N O4.5 |
| Calculated formula |
C17 H24 N O4.5 |
| SMILES |
O=C1CC[C@@H]2N1CCC[C@H]1O[C@@]3(OC(=O)C(=C3)C)[C@H]([C@H]21)CC.O |
| Title of publication |
Tuberostemoamide hemihydrate |
| Authors of publication |
Zhang, Rong-Rong; Ma, Zhi-Guo; Li, Guo-Qiang; But, Paul Pui-Hay; Jiang, Ren-Wang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
11 |
| Pages of publication |
o3056 |
| a |
8.6412 ± 0.0002 Å |
| b |
10.7998 ± 0.0002 Å |
| c |
36.1685 ± 0.0007 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3375.36 ± 0.12 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.053 |
| Residual factor for significantly intense reflections |
0.0497 |
| Weighted residual factors for significantly intense reflections |
0.1376 |
| Weighted residual factors for all reflections included in the refinement |
0.1421 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.064 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232542.html