Information card for entry 2232560
| Chemical name |
6-Fluoro-2-(4-methoxyphenyl)imidazo[2,1-<i>b</i>][1,3]benzothiazole |
| Formula |
C16 H11 F N2 O S |
| Calculated formula |
C16 H11 F N2 O S |
| SMILES |
s1c2c(n3cc(nc13)c1ccc(OC)cc1)ccc(F)c2 |
| Title of publication |
6-Fluoro-2-(4-methoxyphenyl)imidazo[2,1-<i>b</i>][1,3]benzothiazole |
| Authors of publication |
Fun, Hoong-Kun; Hemamalini, Madhukar; Umesha, K.; Sarojini, B. K.; Narayana, B. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
12 |
| Pages of publication |
o3265 - o3266 |
| a |
7.612 ± 0.0013 Å |
| b |
13.883 ± 0.002 Å |
| c |
13.049 ± 0.002 Å |
| α |
90° |
| β |
105.117 ± 0.003° |
| γ |
90° |
| Cell volume |
1331.3 ± 0.4 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.1186 |
| Residual factor for significantly intense reflections |
0.0514 |
| Weighted residual factors for significantly intense reflections |
0.0943 |
| Weighted residual factors for all reflections included in the refinement |
0.1164 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.998 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232560.html