Information card for entry 2232650
| Chemical name |
2,2'-(9,9-Dioctyl-9<i>H</i>-fluorene-2,7-diyl)bis(4,4,5,5-tetramethyl-1,3,2- dioxaborolane) |
| Formula |
C41 H64 B2 O4 |
| Calculated formula |
C41 H64 B2 O4 |
| SMILES |
CC1(C)C(C)(C)OB(c2ccc3c(c2)C(c2c3ccc(c2)B2OC(C(C)(C)O2)(C)C)(CCCCCCCC)CCCCCCCC)O1 |
| Title of publication |
2,2'-(9,9-Dioctyl-9<i>H</i>-fluorene-2,7-diyl)bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane) |
| Authors of publication |
Huang, Lin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
12 |
| Pages of publication |
o3449 |
| a |
12.8429 ± 0.0016 Å |
| b |
13.4909 ± 0.0017 Å |
| c |
14.1641 ± 0.0018 Å |
| α |
110.369 ± 0.002° |
| β |
90.183 ± 0.002° |
| γ |
115.632 ± 0.002° |
| Cell volume |
2039.6 ± 0.4 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0782 |
| Residual factor for significantly intense reflections |
0.0591 |
| Weighted residual factors for significantly intense reflections |
0.1743 |
| Weighted residual factors for all reflections included in the refinement |
0.1887 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.121 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232650.html