Information card for entry 2232897
| Chemical name |
1,1'-{[1,4-Phenylenebis(methylene)]bis(oxy)bis(4,1-phenylene)}diethanone |
| Formula |
C24 H22 O4 |
| Calculated formula |
C24 H22 O4 |
| SMILES |
CC(=O)c1ccc(cc1)OCc1ccc(cc1)COc1ccc(cc1)C(=O)C |
| Title of publication |
1,1'-{[1,4-Phenylenebis(methylene)]bis(oxy)bis(4,1-phenylene)}diethanone |
| Authors of publication |
Al-Mohammed, Nassir N.; Alias, Yatimah; Abdullah, Zanariah; Khaledi, Hamid |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
12 |
| Pages of publication |
o3164 |
| a |
8.1286 ± 0.0012 Å |
| b |
8.161 ± 0.0007 Å |
| c |
8.4878 ± 0.0006 Å |
| α |
116.164 ± 0.005° |
| β |
106.328 ± 0.007° |
| γ |
100.196 ± 0.007° |
| Cell volume |
454.41 ± 0.1 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0443 |
| Residual factor for significantly intense reflections |
0.0404 |
| Weighted residual factors for significantly intense reflections |
0.1085 |
| Weighted residual factors for all reflections included in the refinement |
0.1123 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.073 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232897.html