Information card for entry 2232979
| Chemical name |
5,5'-Bis(naphthalen-2-yl)-2,2'-bi(1,3,4-oxadiazole) |
| Formula |
C24 H14 N4 O2 |
| Calculated formula |
C24 H14 N4 O2 |
| SMILES |
c1ccc2c(c1)cc(cc2)c1nnc(o1)c1nnc(o1)c1ccc2c(c1)cccc2 |
| Title of publication |
5,5'-Bis(naphthalen-2-yl)-2,2'-bi(1,3,4-oxadiazole) |
| Authors of publication |
Wang, Haitao; Jia, Xiaoshi; Qu, Songnan; Bai, Binglian; Li, Min |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
12 |
| Pages of publication |
o3360 |
| a |
7.8982 ± 0.0016 Å |
| b |
5.7107 ± 0.0011 Å |
| c |
21.503 ± 0.005 Å |
| α |
90° |
| β |
109.82 ± 0.03° |
| γ |
90° |
| Cell volume |
912.4 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0571 |
| Residual factor for significantly intense reflections |
0.0386 |
| Weighted residual factors for significantly intense reflections |
0.0993 |
| Weighted residual factors for all reflections included in the refinement |
0.1058 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.069 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232979.html