Information card for entry 2233060
| Chemical name |
(<i>Z</i>)-1-(2,4-Difluorophenyl)-2-(1<i>H</i>-1,2,4-triazol-1-yl)ethanone oxime |
| Formula |
C10 H8 F2 N4 O |
| Calculated formula |
C10 H8 F2 N4 O |
| SMILES |
O/N=C(/c1ccc(F)cc1F)Cn1ncnc1 |
| Title of publication |
(<i>Z</i>)-1-(2,4-Difluorophenyl)-2-(1<i>H</i>-1,2,4-triazol-1-yl)ethanone oxime |
| Authors of publication |
Yu, Guang-yan; Li, Chen; Xiao, Tao; Li, Song; Tian, Xin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
12 |
| Pages of publication |
o3468 |
| a |
8.632 ± 0.0017 Å |
| b |
12.433 ± 0.003 Å |
| c |
10.417 ± 0.002 Å |
| α |
90° |
| β |
104.85 ± 0.03° |
| γ |
90° |
| Cell volume |
1080.6 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1009 |
| Residual factor for significantly intense reflections |
0.0601 |
| Weighted residual factors for significantly intense reflections |
0.1487 |
| Weighted residual factors for all reflections included in the refinement |
0.1714 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.008 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233060.html