Information card for entry 2233067
| Chemical name |
<i>N</i>,<i>N</i>'-Bis(3,3-dimethylallyl)-<i>N</i>,<i>N</i>'- (propane-1,3-diyl)dibenzenesulfonamide |
| Formula |
C25 H34 N2 O4 S2 |
| Calculated formula |
C25 H34 N2 O4 S2 |
| SMILES |
c1(ccccc1)S(=O)(=O)N(CCCN(CC=C(C)C)S(=O)(=O)c1ccccc1)CC=C(C)C |
| Title of publication |
<i>N</i>,<i>N</i>'-Bis(3,3-dimethylallyl)-<i>N</i>,<i>N</i>'-(propane-1,3-diyl)dibenzenesulfonamide |
| Authors of publication |
Khan, Islam Ullah; Sheikh, Tahir Ali; Ejaz; Harrison, William T. A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
12 |
| Pages of publication |
o3507 |
| a |
10.3019 ± 0.0002 Å |
| b |
16.3962 ± 0.0004 Å |
| c |
16.05 ± 0.0004 Å |
| α |
90° |
| β |
108.449 ± 0.001° |
| γ |
90° |
| Cell volume |
2571.71 ± 0.1 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0479 |
| Residual factor for significantly intense reflections |
0.0343 |
| Weighted residual factors for significantly intense reflections |
0.0902 |
| Weighted residual factors for all reflections included in the refinement |
0.1019 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.046 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233067.html