Information card for entry 2233092
| Chemical name |
<i>N</i>-(2,3,4-Trifluorophenyl)pyrrolidine-1-carboxamide |
| Formula |
C11 H11 F3 N2 O |
| Calculated formula |
C11 H11 F3 N2 O |
| SMILES |
O=C(N1CCCC1)Nc1ccc(c(c1F)F)F |
| Title of publication |
<i>N</i>-(2,3,4-Trifluorophenyl)pyrrolidine-1-carboxamide |
| Authors of publication |
Pei, Shuchen; Li, Jie; Qu, Boyi; Hai, Li; Wu, Yong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
1 |
| Pages of publication |
o12 |
| a |
6.0708 ± 0.0004 Å |
| b |
24.2124 ± 0.0015 Å |
| c |
7.4232 ± 0.0006 Å |
| α |
90° |
| β |
100.508 ± 0.007° |
| γ |
90° |
| Cell volume |
1072.83 ± 0.13 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0899 |
| Residual factor for significantly intense reflections |
0.0544 |
| Weighted residual factors for significantly intense reflections |
0.1285 |
| Weighted residual factors for all reflections included in the refinement |
0.1508 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.038 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233092.html