Information card for entry 2233164
| Chemical name |
9-(7-Fluoro-4-oxo-4<i>H</i>-chromen-3-yl)-3,3,6,6-tetramethyl- 2,3,4,5,6,7,8,9-octahydro-1<i>H</i>-xanthene-1,8-dione |
| Formula |
C26 H25 F O5 |
| Calculated formula |
C26 H25 F O5 |
| SMILES |
Fc1cc2occ(c(=O)c2cc1)C1C2=C(OC3=C1C(=O)CC(C3)(C)C)CC(CC2=O)(C)C |
| Title of publication |
9-(7-Fluoro-4-oxo-4<i>H</i>-chromen-3-yl)-3,3,6,6-tetramethyl-2,3,4,5,6,7,8,9-octahydro-1<i>H</i>-xanthene-1,8-dione |
| Authors of publication |
Asad, Mohammad; Oo, Chuan-Wei; Osman, Hasnah; Fun, Hoong-Kun; Arshad, Suhana |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
1 |
| Pages of publication |
o38 |
| a |
6.9475 ± 0.0008 Å |
| b |
18.596 ± 0.002 Å |
| c |
17.559 ± 0.002 Å |
| α |
90° |
| β |
93.658 ± 0.002° |
| γ |
90° |
| Cell volume |
2263.9 ± 0.4 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.085 |
| Residual factor for significantly intense reflections |
0.0518 |
| Weighted residual factors for significantly intense reflections |
0.1304 |
| Weighted residual factors for all reflections included in the refinement |
0.1501 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.029 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233164.html