Information card for entry 2233295
| Chemical name |
4,6-Dichloro-2-{[(<i>E</i>)-(3-{[(<i>E</i>)-3,5-dichloro-2-hydroxybenzylidene]amino}-2,2-dimethylpropyl)imino]methyl}phenol |
| Formula |
C19 H18 Cl4 N2 O2 |
| Calculated formula |
C19 H18 Cl4 N2 O2 |
| SMILES |
Clc1cc(c(O)c(Cl)c1)/C=N/CC(C)(C)C/N=C/c1c(O)c(Cl)cc(Cl)c1 |
| Title of publication |
4,6-Dichloro-2-{[(<i>E</i>)-(3-{[(<i>E</i>)-3,5-dichloro-2-hydroxybenzylidene]amino}-2,2-dimethylpropyl)imino]methyl}phenol |
| Authors of publication |
Kargar, Hadi; Kia, Reza; Abbasian, Saeideh; Tahir, Muhammad Nawaz |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
1 |
| Pages of publication |
o142 |
| a |
16.5265 ± 0.0005 Å |
| b |
10.3242 ± 0.0003 Å |
| c |
12.6433 ± 0.0004 Å |
| α |
90° |
| β |
104.796 ± 0.001° |
| γ |
90° |
| Cell volume |
2085.71 ± 0.11 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0691 |
| Residual factor for significantly intense reflections |
0.0418 |
| Weighted residual factors for significantly intense reflections |
0.104 |
| Weighted residual factors for all reflections included in the refinement |
0.1187 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.034 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233295.html