Information card for entry 2233301
| Chemical name |
(1<i>E</i>,4<i>E</i>)-1-(3-Nitrophenyl)-5-phenylpenta-1,4-dien-3-one |
| Formula |
C17 H13 N O3 |
| Calculated formula |
C17 H13 N O3 |
| SMILES |
O=N(=O)c1cc(ccc1)/C=C/C(=O)/C=C/c1ccccc1 |
| Title of publication |
(1<i>E</i>,4<i>E</i>)-1-(3-Nitrophenyl)-5-phenylpenta-1,4-dien-3-one |
| Authors of publication |
Samshuddin, S.; Butcher, Ray J.; Akkurt, Mehmet; Narayana, B.; Sarojini, B. K.; Yathirajan, H. S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
1 |
| Pages of publication |
o74 - o75 |
| a |
11.9806 ± 0.0006 Å |
| b |
9.8955 ± 0.0004 Å |
| c |
12.5562 ± 0.0007 Å |
| α |
90° |
| β |
114.992 ± 0.007° |
| γ |
90° |
| Cell volume |
1349.21 ± 0.14 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0965 |
| Residual factor for significantly intense reflections |
0.055 |
| Weighted residual factors for significantly intense reflections |
0.1076 |
| Weighted residual factors for all reflections included in the refinement |
0.1276 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.019 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233301.html