Information card for entry 2233447
| Chemical name |
<i>N</i>,<i>N</i>'-Dibenzyl-<i>N</i>''-(2,4-difluorobenzoyl)- <i>N</i>,<i>N</i>'-dimethylphosphoric triamide |
| Formula |
C23 H24 F2 N3 O2 P |
| Calculated formula |
C23 H24 F2 N3 O2 P |
| SMILES |
P(=O)(NC(=O)c1ccc(F)cc1F)(N(Cc1ccccc1)C)N(Cc1ccccc1)C |
| Title of publication |
<i>N</i>,<i>N</i>'-Dibenzyl-<i>N</i>''-(2,4-difluorobenzoyl)-<i>N</i>,<i>N</i>'-dimethylphosphoric triamide |
| Authors of publication |
Pourayoubi, Mehrdad; Shoghpour, Samad; Torre-Fernández, Laura; García-Granda, Santiago |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
2 |
| Pages of publication |
o270 - o271 |
| a |
10.3619 ± 0.0006 Å |
| b |
10.7721 ± 0.001 Å |
| c |
11.6433 ± 0.0008 Å |
| α |
70.523 ± 0.007° |
| β |
72.495 ± 0.005° |
| γ |
70.197 ± 0.007° |
| Cell volume |
1126.65 ± 0.16 Å3 |
| Cell temperature |
300 ± 2 K |
| Ambient diffraction temperature |
300 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0834 |
| Residual factor for significantly intense reflections |
0.0505 |
| Weighted residual factors for significantly intense reflections |
0.1206 |
| Weighted residual factors for all reflections included in the refinement |
0.1405 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.006 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233447.html