Information card for entry 2233767
| Chemical name |
1,2,3-Trimethoxy-4,5,6-trinitrobenzene |
| Formula |
C9 H9 N3 O9 |
| Calculated formula |
C9 H9 N3 O9 |
| SMILES |
O(c1c(OC)c(OC)c(N(=O)=O)c(N(=O)=O)c1N(=O)=O)C |
| Title of publication |
1,2,3-Trimethoxy-4,5,6-trinitrobenzene |
| Authors of publication |
Merten, Günter J.; Neis, Christian; Hegetschweiler, Kaspar |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
3 |
| Pages of publication |
o694 |
| a |
8.1743 ± 0.0004 Å |
| b |
16.6121 ± 0.0009 Å |
| c |
9.0856 ± 0.0005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1233.75 ± 0.11 Å3 |
| Cell temperature |
153 ± 2 K |
| Ambient diffraction temperature |
153 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.052 |
| Residual factor for significantly intense reflections |
0.0344 |
| Weighted residual factors for significantly intense reflections |
0.0724 |
| Weighted residual factors for all reflections included in the refinement |
0.0806 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.015 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233767.html