Information card for entry 2233830
| Chemical name |
3,3'-[1,2-Phenylenebis(methylene)]bis(1-ethylbenzimidazolium) dibromide |
| Formula |
C26 H28 Br2 N4 |
| Calculated formula |
C26 H28 Br2 N4 |
| SMILES |
[Br-].[Br-].n1(CC)c2ccccc2[n+](c1)Cc1ccccc1Cn1c2ccccc2[n+](c1)CC |
| Title of publication |
3,3'-[1,2-Phenylenebis(methylene)]bis(1-ethylbenzimidazolium) dibromide |
| Authors of publication |
Haque, Rosenani A.; Iqbal, Muhammad Adnan; Budagumpi, Srinivasa; Hemamalini, Madhukar; Fun, Hoong-Kun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
3 |
| Pages of publication |
o573 |
| a |
9.7093 ± 0.0007 Å |
| b |
35.796 ± 0.003 Å |
| c |
8.034 ± 0.0006 Å |
| α |
90° |
| β |
118.23 ± 0.001° |
| γ |
90° |
| Cell volume |
2460.1 ± 0.3 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
9 |
| Hermann-Mauguin space group symbol |
C 1 c 1 |
| Hall space group symbol |
C -2yc |
| Residual factor for all reflections |
0.0511 |
| Residual factor for significantly intense reflections |
0.0331 |
| Weighted residual factors for significantly intense reflections |
0.0743 |
| Weighted residual factors for all reflections included in the refinement |
0.0804 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.015 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233830.html