Information card for entry 2233967
| Chemical name |
6-Methyl-3-phenyl-2-sulfanylidene-1,2,3,4-tetrahydroquinazolin-4-one |
| Formula |
C15 H12 N2 O S |
| Calculated formula |
C15 H12 N2 O S |
| SMILES |
S=C1N(C(=O)c2cc(ccc2N1)C)c1ccccc1 |
| Title of publication |
6-Methyl-3-phenyl-2-sulfanylidene-1,2,3,4-tetrahydroquinazolin-4-one |
| Authors of publication |
El-Azab, Adel S.; Abdel-Aziz, Alaa A.-M.; Ng, Seik Weng; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
3 |
| Pages of publication |
o862 |
| a |
12.777 ± 0.0003 Å |
| b |
5.1384 ± 0.0001 Å |
| c |
19.0973 ± 0.0004 Å |
| α |
90° |
| β |
91.814 ± 0.002° |
| γ |
90° |
| Cell volume |
1253.17 ± 0.05 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0368 |
| Residual factor for significantly intense reflections |
0.0332 |
| Weighted residual factors for significantly intense reflections |
0.0935 |
| Weighted residual factors for all reflections included in the refinement |
0.0975 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.063 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233967.html