Information card for entry 2234016
| Chemical name |
5-Fluoro-6'<i>H</i>,7'<i>H</i>,8'<i>H</i>-spiro[indoline-3,7'- pyrano[3,2-<i>c</i>:5,6-<i>c</i>']di-1-benzopyran]-2,6',8'-trione |
| Formula |
C26 H12 F N O6 |
| Calculated formula |
C26 H12 F N O6 |
| SMILES |
c12c(C3(c4c(c5c(cccc5)oc4=O)O2)c2cc(ccc2NC3=O)F)c(=O)oc2c1cccc2 |
| Title of publication |
5-Fluoro-6'<i>H</i>,7'<i>H</i>,8'<i>H</i>-spiro[indoline-3,7'-pyrano[3,2-<i>c</i>:5,6-<i>c</i>']di-1-benzopyran]-2,6',8'-trione |
| Authors of publication |
Almansour, Abdulrahman I.; Kumar, Raju Suresh; Arumugam, Natarajan; Devi Shree, P.; Suresh, J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
3 |
| Pages of publication |
o744 |
| a |
7.8262 ± 0.0001 Å |
| b |
10.9278 ± 0.0001 Å |
| c |
12.4067 ± 0.0002 Å |
| α |
113.374 ± 0.001° |
| β |
94.922 ± 0.001° |
| γ |
100.295 ± 0.001° |
| Cell volume |
943.77 ± 0.02 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0577 |
| Residual factor for significantly intense reflections |
0.0449 |
| Weighted residual factors for significantly intense reflections |
0.1145 |
| Weighted residual factors for all reflections included in the refinement |
0.1243 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.041 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234016.html