Information card for entry 2234022
| Common name |
2-((<i>E</i>)-{3-[(<i>E</i>)-2-Hydroxy-3,5-diiodobenzylideneamino]- 2,2-dimethylpropyl}iminomethyl)-4,6-diiodophenol |
| Chemical name |
2-((<i>E</i>)-{3-[(<i>E</i>)-2-Hydroxy-3,5-diiodobenzylideneamino]- 2,2-dimethylpropyl}iminomethyl)-4,6-diiodophenol |
| Formula |
C19 H18 I4 N2 O2 |
| Calculated formula |
C19 H18 I4 N2 O2 |
| SMILES |
IC1=C/C(=C/NCC(CN/C=C2/C=C(I)C=C(C2=O)I)(C)C)C(=O)C(=C1)I |
| Title of publication |
2-((<i>E</i>)-{3-[(<i>E</i>)-2-Hydroxy-3,5-diiodobenzylideneamino]-2,2-dimethylpropyl}iminomethyl)-4,6-diiodophenol |
| Authors of publication |
Kargar, Hadi; Kia, Reza; Shakarami, Tayebeh; Tahir, Muhammad Nawaz |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
3 |
| Pages of publication |
o564 |
| a |
12.2057 ± 0.0005 Å |
| b |
11.8169 ± 0.0005 Å |
| c |
31.8157 ± 0.0015 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
4588.9 ± 0.3 Å3 |
| Cell temperature |
291 ± 2 K |
| Ambient diffraction temperature |
291 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.1166 |
| Residual factor for significantly intense reflections |
0.0436 |
| Weighted residual factors for significantly intense reflections |
0.0628 |
| Weighted residual factors for all reflections included in the refinement |
0.0794 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.004 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234022.html