Information card for entry 2234185
| Chemical name |
<i>N</i>,<i>N</i>-Dimethyl-4-[(<i>E</i>)-2-(3,6,7-tribromo-9-butyl-9<i>H</i>- carbazol-2-yl)ethenyl]aniline |
| Formula |
C26 H25 Br3 N2 |
| Calculated formula |
C26 H25 Br3 N2 |
| SMILES |
Brc1cc2n(CCCC)c3c(c2cc1Br)cc(Br)c(c3)/C=C/c1ccc(N(C)C)cc1 |
| Title of publication |
<i>N</i>,<i>N</i>-Dimethyl-4-[(<i>E</i>)-2-(3,6,7-tribromo-9-butyl-9<i>H</i>-carbazol-2-yl)ethenyl]aniline |
| Authors of publication |
Kumar, Sushil; Thomas, K. R. Justin; Ng, Seik Weng; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
4 |
| Pages of publication |
o1121 |
| a |
9.7304 ± 0.0003 Å |
| b |
11.3834 ± 0.0004 Å |
| c |
11.8197 ± 0.0004 Å |
| α |
114.308 ± 0.003° |
| β |
101.957 ± 0.003° |
| γ |
90.127 ± 0.003° |
| Cell volume |
1161.62 ± 0.08 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0326 |
| Residual factor for significantly intense reflections |
0.0318 |
| Weighted residual factors for significantly intense reflections |
0.0914 |
| Weighted residual factors for all reflections included in the refinement |
0.0923 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.074 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234185.html